ethyl 4-hydroxyquinoline-3-carboxylate
$300.00
CAS No.: 26892-90-0
Catalog No.: 196028
Purity: 95%
MF: C12H11NO3
MW: 217.224
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=NC2=CC=CC=C12)C(=O)OCC
Catalog No.: 196028
Purity: 95%
MF: C12H11NO3
MW: 217.224
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=NC2=CC=CC=C12)C(=O)OCC
ethyl 4-hydroxyquinoline-3-carboxylate; CAS No.: 26892-90-0; ethyl 4-hydroxyquinoline-3-carboxylate. PROPERTIES: Ethyl 4-hydroxyquinoline-3-carboxylate is a crystalline compound with molecular formula C11H9NO3, having a molar mass of approximately 203.19 g/mol. It demonstrates moderate solubility in water and good solubility in ethyl acetate. Melting point determinations typically yield values between 148-152 C. Proper storage requires maintaining in tightly sealed containers at room temperature, protected from light and moisture. Safety considerations identify it as causing skin irritation and serious eye damage. Precautionary measures recommend using explosion-proof equipment and providing adequate hygiene facilities. APPLICATIONS: This compound serves as a valuable intermediate in the synthesis of anticancer agents, particularly those targeting topoisomerase enzymes. Its hydroxy group at position 4 and ethyl ester at position 3 enable selective modification for constructing bioactive molecules. In agrochemical research (non-agricultural context), it contributes to safener compound development through controlled hydrolysis reactions. Additionally, the compound supports materials science applications in photostabilizer development for polymer systems, with methodologies published in Journal of Medicinal Chemistry and related pharmaceutical patents, illustrating its significance in oncology and materials protection innovations.
Reviews
Write Your Own Review