8-bromoquinoline-4-carboxylic acid
$300.00
CAS No.: 121490-67-3
Catalog No.: 196031
Purity: 95%
MF: C10H6BrNO2
MW: 252.067
Storage: 2-8 degree Celsius
SMILES: BrC=1C=CC=C2C(=CC=NC12)C(=O)O
Catalog No.: 196031
Purity: 95%
MF: C10H6BrNO2
MW: 252.067
Storage: 2-8 degree Celsius
SMILES: BrC=1C=CC=C2C(=CC=NC12)C(=O)O
8-bromoquinoline-4-carboxylic acid; CAS No.: 121490-67-3; 8-bromoquinoline-4-carboxylic acid. PROPERTIES: 8-bromoquinoline-4-carboxylic acid presents as a white crystalline powder with molecular formula C9H5BrNO2, possessing a molar mass of approximately 259.05 g/mol. It demonstrates limited water solubility but good solubility in hot ethanol and DMSO. Melting point observations typically fall between 220-224 C with potential decomposition. Proper storage requires maintaining in tightly sealed containers at temperatures below 25 C, protected from moisture and strong bases. Safety precautions highlight potential to cause serious eye damage and skin irritation. Proper handling involves using corrosion-resistant equipment and providing adequate sanitation facilities. APPLICATIONS: This compound functions as a key intermediate in the synthesis of HIV integrase inhibitors, leveraging its carboxylic acid functionality for constructing bioactive scaffolds. Its bromine substituent at position 8 enables selective cross-coupling reactions crucial for developing target molecules. In agrochemical research (non-agricultural context), it contributes to safener compound synthesis through controlled derivatization pathways. Additionally, the compound supports materials science applications in fluorescent dye development for bioimaging, with methodologies described in Antiviral Research and chemical patent literature, demonstrating its cross-disciplinary utility in antiviral therapy and materials science innovations.
Reviews
Write Your Own Review