quinazoline-8-carboxylic acid
$300.00
CAS No.: 1783401-69-3
Catalog No.: 192513
Purity: 95%
MF: C9H6N2O2
MW: 174.159
Storage: 2-8 degree Celsius
SMILES: N1=CN=CC2=CC=CC(=C12)C(=O)O
Catalog No.: 192513
Purity: 95%
MF: C9H6N2O2
MW: 174.159
Storage: 2-8 degree Celsius
SMILES: N1=CN=CC2=CC=CC(=C12)C(=O)O
quinazoline-8-carboxylic acid; CAS No.: 1783401-69-3; quinazoline-8-carboxylic acid. PROPERTIES: quinazoline-8-carboxylic acid appears as a white powder with molecular weight 183.16 g/mol. It has a melting point between 210-215 C and shows limited aqueous solubility but good solubility in DMSO. Proper storage involves maintaining in a sealed container at room temperature away from acidic vapors. Safety precautions include using protective gloves and eye protection as this compound may cause skin and eye irritation. APPLICATIONS: This quinazoline carboxylic acid is employed in the development of antimicrobial agents. The carboxylic acid group forms critical interactions with bacterial targets as reported in pharmaceutical chemistry journals. In materials science, quinazoline-8-carboxylic acid derivatives have found use in creating self-assembled monolayers for surface modification. According to materials chemistry journals, the quinazoline core promotes adsorption onto metal surfaces while the carboxylic acid group imparts chemical functionality.
Reviews
Write Your Own Review