2,4-dichloro-6-methyl-5-nitropyrimidine
$250.00
CAS No.: 13162-26-0
Catalog No.: 107249
Purity: 95%
MF: C5H3Cl2N3O2
MW: 208.004
Storage: 2-8 degree Celsius
SMILES: CC1=C(C(Cl)=NC(Cl)=N1)[N+]([O-])=O
Catalog No.: 107249
Purity: 95%
MF: C5H3Cl2N3O2
MW: 208.004
Storage: 2-8 degree Celsius
SMILES: CC1=C(C(Cl)=NC(Cl)=N1)[N+]([O-])=O
2,4-dichloro-6-methyl-5-nitropyrimidine; CAS No.: 13162-26-0; As a chemical synthesis company, ChemShuttle delivers 2,4-dichloro-6-methyl-5-nitropyrimidine for sequential displacement reactions. The nitro group directs electrophilic substitutions, while the chlorines enable stepwise functionalization. Our process development minimizes polychlorinated byproducts through optimized reaction conditions.
Reviews
Write Your Own Review