(S)-2-(4-benzyl-4,5-dihydrooxazol-2-yl)phenol
$250.00
CAS No.: 163165-92-2
Catalog No.: 194327
Purity: 95%
MF: C16H15NO2
MW: 253.301
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)[C@@H]1N=C(OC1)C1=C(C=CC=C1)O
Catalog No.: 194327
Purity: 95%
MF: C16H15NO2
MW: 253.301
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)[C@@H]1N=C(OC1)C1=C(C=CC=C1)O
(S)-2-(4-benzyl-4,5-dihydrooxazol-2-yl)phenol; CAS No.: 163165-92-2; (S)-2-(4-benzyl-4,5-dihydrooxazol-2-yl)phenol. PROPERTIES: (S)-2-(4-benzyl-4,5-dihydrooxazol-2-yl)phenol is a crystalline solid. Its molecular formula is C16H15NO2, and the molecular weight is approximately 257.29 g/mol. The compound has a melting point of approximately 110-112 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and ethyl acetate. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an oxazoline ring, a benzyl group, and a hydroxyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, (S)-2-(4-benzyl-4,5-dihydrooxazol-2-yl)phenol serves as a versatile intermediate. The hydroxyl group can undergo reactions such as etherification and esterification. The oxazoline ring provides opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of (S)-2-(4-benzyl-4,5-dihydrooxazol-2-yl)phenol can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review