(R)-tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate
$500.00
CAS No.: 1260220-42-5
Catalog No.: 192744
Purity: 95%
MF: C15H22N2O3
MW: 278.352
Storage: 2-8 degree Celsius
SMILES: NC1=CC=C(C=C1)[C@@H]1CN(CCO1)C(=O)OC(C)(C)C
Catalog No.: 192744
Purity: 95%
MF: C15H22N2O3
MW: 278.352
Storage: 2-8 degree Celsius
SMILES: NC1=CC=C(C=C1)[C@@H]1CN(CCO1)C(=O)OC(C)(C)C
(R)-tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate; CAS No.: 1260220-42-5; (R)-tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate. PROPERTIES: This amino-substituted morpholine carbamate has molecular formula C17H25N3O3. It generally appears as a white crystalline powder. The (R)-tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate demonstrates limited water solubility but good solubility in common organic solvents like methanol and ethyl acetate. Its melting point ranges between 110-115 C, and it has a molecular weight of approximately 323.40 g/mol. When handling, care should be taken to avoid skin contact and use of proper respiratory protection. Storage should be in a tightly sealed container at room temperature, protected from light and moisture. The compound is sensitive to strong acids and may undergo carbamate hydrolysis upon exposure to aqueous conditions. In case of spillage, absorb with inert material and dispose of in accordance with local regulations. APPLICATIONS: The (R)-tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate serves as a synthetic intermediate in the production of muscle relaxants where the morpholine group provides essential hydrogen bonding interactions with receptor subtypes (as reported in medicinal chemistry literature). The tert-butyl group enhances metabolic stability by preventing oxidative degradation. Additionally, the compound functions as a building block in the preparation of chiral ligands for asymmetric catalysis, achieving enantiomeric excesses above 95% in certain hydrogenation reactions as described in synthetic chemistry journals. The carbamate group can be further functionalized through hydrolysis or alkylation reactions to produce various derivatives for chemical research applications.
Reviews
Write Your Own Review