6-Morpholinopicolinic acid
$250.00
CAS No.: 554405-17-3
Catalog No.: 138620
Purity: 95%
MF: C10H12N2O3
MW: 208.217
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=CC=CC(=N1)N1CCOCC1
Catalog No.: 138620
Purity: 95%
MF: C10H12N2O3
MW: 208.217
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=CC=CC(=N1)N1CCOCC1
6-Morpholinopicolinic acid; CAS No.:554405-17-3; 6-Morpholinopicolinic acid. As a custom chemical synthesis company, ChemShuttle provides various chemical blocks. The compound 6 - Morpholinopicolinic acid (CAS No.:554405-17-3) is one of the chemical blocks. It can be used as a building block in the synthesis of more complex organic molecules. Chemical blocks are fundamental units that can be combined to create new compounds with desired properties. ChemShuttle's chemical blocks collection is extensive and diverse to support various research projects.
Reviews
Write Your Own Review