2-fluoro-4-morpholinobenzoic acid
$150.00
CAS No.: 946598-40-9
Catalog No.: 138619
Purity: 95%
MF: C11H12FNO3
MW: 225.219
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C(F)C=C(C=C1)N1CCOCC1
Catalog No.: 138619
Purity: 95%
MF: C11H12FNO3
MW: 225.219
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C(F)C=C(C=C1)N1CCOCC1
2-fluoro-4-morpholinobenzoic acid; CAS No.:946598-40-9; 2-fluoro-4-morpholinobenzoic acid. ChemShuttle, a chemical synthesis company, provides various building blocks. The compound 2 - fluoro - 4 - morpholinobenzoic acid (CAS No.:946598-40-9) is one of the building blocks. It can be used in the synthesis of various organic compounds. Building blocks are fundamental units that can be combined to create new molecules with specific properties. ChemShuttle's building blocks collection is extensive and diverse to support various research and industrial applications.
Reviews
Write Your Own Review