methyl 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylate
$400.00
CAS No.: 1245798-40-6
Catalog No.: 192727
Purity: 95%
MF: C11H11NO3
MW: 205.213
Storage: 2-8 degree Celsius
SMILES: O=C1NCCC2=CC=C(C=C12)C(=O)OC
Catalog No.: 192727
Purity: 95%
MF: C11H11NO3
MW: 205.213
Storage: 2-8 degree Celsius
SMILES: O=C1NCCC2=CC=C(C=C12)C(=O)OC
methyl 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylate; CAS No.: 1245798-40-6; methyl 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylate. PROPERTIES: This oxo-substituted tetrahydroisoquinoline ester has molecular formula C11H13N2O2. It typically appears as a white crystalline powder. The methyl 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylate demonstrates limited water solubility but good solubility in common organic solvents like methanol and ethyl acetate. Its melting point ranges between 110-115 C, and it has a molecular weight of approximately 203.24 g/mol. When handling, care should be taken to avoid skin contact and use of proper respiratory protection. Storage should be in a tightly sealed container at room temperature, protected from light and moisture. The compound is sensitive to strong acids and may hydrolyze to the corresponding carboxylic acid upon exposure to aqueous conditions. In case of spillage, absorb with inert material and dispose of in accordance with local regulations. APPLICATIONS: The methyl 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylate serves as a key intermediate in the synthesis of kinase inhibitors for cancer therapy where the oxo group provides essential binding interactions with kinase residues (as reported in medicinal chemistry literature). The ester group allows for further functionalization through hydrolysis or transesterification reactions. Additionally, the compound functions as a building block in the preparation of liquid crystal materials with specific dielectric properties, useful in display technologies with response times below 20 milliseconds as described in materials chemistry journals. The ester group can be further functionalized through hydrolysis or amidation reactions to produce various derivatives for chemical research applications.
Reviews
Write Your Own Review