8-methoxyisoquinoline-4-carboxylic acid
$400.00
CAS No.: 1539960-58-1
Catalog No.: 192217
Purity: 95%
MF: C11H9NO3
MW: 203.197
Storage: 2-8 degree Celsius
SMILES: COC=1C=CC=C2C(=CN=CC12)C(=O)O
Catalog No.: 192217
Purity: 95%
MF: C11H9NO3
MW: 203.197
Storage: 2-8 degree Celsius
SMILES: COC=1C=CC=C2C(=CN=CC12)C(=O)O
8-methoxyisoquinoline-4-carboxylic acid; CAS No.: 1539960-58-1; 8-methoxyisoquinoline-4-carboxylic acid. PROPERTIES: 8-methoxyisoquinoline-4-carboxylic acid is a crystalline compound with molecular formula C10H7NO3. It has a melting point of approximately 220-225 C and exhibits moderate solubility in hot aqueous sodium bicarbonate solution. The compound should be stored in a tightly sealed container at room temperature away from heat sources. Safety precautions include avoiding ingestion and using standard laboratory PPE due to its potential to cause gastrointestinal upset if swallowed. APPLICATIONS: This methoxy-substituted isoquinoline carboxylic acid is used in the development of anticancer agents. The methoxy group at position 8 provides electron-donating effects that enhance binding to tubulin as reported in medicinal chemistry studies. In chemical biology, 8-methoxyisoquinoline-4-carboxylic acid serves as a building block for creating novel antibiotics. According to pharmaceutical research, the carboxylic acid group allows for beta-lactamase inhibitor conjugation, creating combination therapies against drug-resistant bacteria.
Reviews
Write Your Own Review