5-aminoisoquinoline-8-carboxylic acid
$350.00
CAS No.: 887591-08-4
Catalog No.: 191947
Purity: 95%
MF: C10H8N2O2
MW: 188.186
Storage: 2-8 degree Celsius
SMILES: NC1=C2C=CN=CC2=C(C=C1)C(=O)O
Catalog No.: 191947
Purity: 95%
MF: C10H8N2O2
MW: 188.186
Storage: 2-8 degree Celsius
SMILES: NC1=C2C=CN=CC2=C(C=C1)C(=O)O
5-aminoisoquinoline-8-carboxylic acid; CAS No.: 887591-08-4; 5-aminoisoquinoline-8-carboxylic acid. PROPERTIES: 5-aminoisoquinoline-8-carboxylic acid (CAS No.: 887591-08-4) appears as a white crystalline powder with a melting point ranging between 235-238 C. The compound features an isoquinoline nucleus with an amino group at position 5 and a carboxylic acid at position 8, exhibiting dual functionality that imparts distinct chemical reactivity. Its carboxylic acid group demonstrates typical acidity with a pKa around 3.5, while the amino group shows moderate basicity (pKa ~5.8). Solubility characteristics reveal good dissolvability in polar solvents like methanol and DMF, with limited water solubility due to the hydrophobic aromatic system. The substance is sensitive to both moisture and light, necessitating storage in a desiccator with silica gel under nitrogen atmosphere at controlled temperature (15-25 C). Safety protocols recommend N95 respiratory protection, neoprene gloves, and safety goggles due to potential skin irritation and eye damage. The compound has a relatively high flash point (>100 C) but generates dust that may form explosive mixtures with air. APPLICATIONS: 5-aminoisoquinoline-8-carboxylic acid functions as a critical intermediate in synthesizing antibacterial agents targeting multidrug-resistant Gram-negative pathogens as documented in antimicrobial research. Its structural framework enables the development of matrix metalloproteinase inhibitors for connective tissue disorder treatments, as reported in pharmaceutical chemistry literature. Additionally, 887591-08-4 serves as a building block for fluorescent DNA intercalators used in genetic research, with several studies highlighting its role in creating sequence-specific DNA binding agents for molecular biology applications.
Reviews
Write Your Own Review