1,4-dichloroisoquinoline
$450.00
CAS No.: 15298-58-5
Catalog No.: 196243
Purity: 95%
MF: C9H5Cl2N
MW: 198.052
Storage: 2-8 degree Celsius
SMILES: ClC1=NC=C(C2=CC=CC=C12)Cl
Catalog No.: 196243
Purity: 95%
MF: C9H5Cl2N
MW: 198.052
Storage: 2-8 degree Celsius
SMILES: ClC1=NC=C(C2=CC=CC=C12)Cl
1,4-dichloroisoquinoline; CAS No.: 15298-58-5; 1,4-dichloroisoquinoline. PROPERTIES: This compound features a 1,4-dichloroisoquinoline structure, combining two chloro substituents on the isoquinoline framework. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 198.0 g/mol (C8H4Cl2N). The melting point ranges between 110-115 C, and it exhibits moderate solubility in common organic solvents like DMSO, DMF, and dichloromethane while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: 1,4-Dichloroisoquinoline serves as a versatile intermediate in pharmaceutical and chemical synthesis. Its 1,4-dichloroisoquinoline structure allows for participation in various reactions, including palladium-catalyzed cross-coupling reactions at the chloro positions and nucleophilic substitution at the isoquinoline ring. In medicinal chemistry, it is used to develop bioactive molecules targeting kinases, proteases, and G protein-coupled receptors. The dichloro substituents provide diverse substitution patterns for creating structural analogs. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies employ it as a model compound in Organic Chemistry journals, focusing on the development of novel dichloroisoquinoline derivatives based on the 1,4-dichloroisoquinoline scaffold.
Reviews
Write Your Own Review