methyl 7-fluoro-2-oxoindoline-4-carboxylate
$335.00
CAS No.: 1260776-33-7
Catalog No.: 193819
Purity: 95%
MF: C10H8FNO3
MW: 209.176
Storage: 2-8 degree Celsius
SMILES: FC1=CC=C(C=2CC(NC12)=O)C(=O)OC
Catalog No.: 193819
Purity: 95%
MF: C10H8FNO3
MW: 209.176
Storage: 2-8 degree Celsius
SMILES: FC1=CC=C(C=2CC(NC12)=O)C(=O)OC
methyl 7-fluoro-2-oxoindoline-4-carboxylate; CAS No.: 1260776-33-7;methyl 7-fluoro-2-oxoindoline-4-carboxylate. PROPERTIES: Methyl 7-fluoro-2-oxoindoline-4-carboxylate is a fluorinated indoline derivative with molecular formula C10H7FNO3. It generally appears as a white to off-white crystalline powder with a melting point of approximately 178-182 C. The compound has low water solubility but dissolves in polar organic solvents like DMSO or DMF. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases. Proper storage involves keeping it in airtight containers below 20 C, protected from light and moisture. APPLICATIONS: In pharmaceutical synthesis, this compound serves as an intermediate for preparing antimicrobial and anticancer agents. The fluorine substituent on the indoline ring influences binding affinity to biological targets, while the methyl ester provides a handle for further functionalization (Journal of Medicinal Chemistry). In materials science, the compound contributes to the development of fluorescent probes and sensors, where its indoline core and fluorine substituent modulate photophysical properties for detecting specific analytes (Analytical Chemistry). The oxo group on the indoline ring enables formation of coordination complexes with metal ions, expanding applications in supramolecular chemistry and catalysis (Dalton Transactions).
Reviews
Write Your Own Review