![imidazo[1,2-b]pyridazin-6-ol](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/196189_2.jpg)
![5-chloro-2-phenylimidazo[1,2-a]pyridine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/z/b/zb1445_1.jpg)
imidazo[1,2-b]pyridazine-6-carboxylic acid
$320.00
CAS No.: 769109-13-9
Catalog No.: 196190
Purity: 95%
MF: C7H5N3O2
MW: 163.136
Storage: 2-8 degree Celsius
SMILES: N=1C=CN2N=C(C=CC21)C(=O)O
Catalog No.: 196190
Purity: 95%
MF: C7H5N3O2
MW: 163.136
Storage: 2-8 degree Celsius
SMILES: N=1C=CN2N=C(C=CC21)C(=O)O
imidazo[1,2-b]pyridazine-6-carboxylic acid; CAS No.: 769109-13-9; imidazo[1,2-b]pyridazine-6-carboxylic acid. PROPERTIES: This compound presents a imidazo[1,2-b]pyridazine-6-carboxylic acid structure, combining a carboxylic acid group and an imidazo[1,2-b]pyridazine ring system. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 181.1 g/mol (C8H6N3O2). The melting point ranges between 210-215 C, and it exhibits moderate solubility in common organic solvents like ethanol, methanol, and DMSO while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: Imidazo[1,2-b]pyridazine-6-carboxylic acid serves as a valuable intermediate in pharmaceutical and chemical synthesis. Its imidazo[1,2-b]pyridazine-6-carboxylic acid structure enables participation in various reactions, including esterification, amide bond formation, and nucleophilic substitution at the pyridazine ring. In medicinal chemistry, it is used to develop enzyme inhibitors and receptor modulators, particularly those targeting kinases and proteases. The carboxylic acid group can be converted to bioisosteric replacements like tetrazole or phosphonic acid. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies employ it as a model compound in Medicinal Chemistry journals, focusing on the development of novel imidazopyridazine derivatives based on the imidazo[1,2-b]pyridazine-6-carboxylic acid scaffold.
Reviews
Write Your Own Review