![methyl 3-bromoimidazo[1,2-b]pyridazine-6-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171372_1.jpg)
![8-bromo-6-chloro-2-methylimidazo[1,2-b]pyridazine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/197700_2.jpg)
ethyl 6-bromoimidazo[1,2-b]pyridazine-2-carboxylate
$295.00
CAS No.: 1187236-98-1
Catalog No.: 171523
Purity: 95%
MF: C9H8BrN3O2
MW: 270.086
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CN2N=C(Br)C=CC2=N1
Catalog No.: 171523
Purity: 95%
MF: C9H8BrN3O2
MW: 270.086
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CN2N=C(Br)C=CC2=N1
ethyl 6-bromoimidazo[1,2-b]pyridazine-2-carboxylate; CAS No.: 1187236-98-1; ethyl 6-bromoimidazo[1,2-b]pyridazine-2-carboxylate is a heterocycle offered by ChemShuttle, a chemical online store. It is utilized in CRO chemical synthesis, providing valuable options for researchers. This compound is a screening compound that can be used to identify potential bioactive molecules. Its unique structure makes it a significant asset in the exploration of new chemical entities and the advancement of scientific research.
Reviews
Write Your Own Review