2,5-diphenylfuran
$200.00
CAS No.: 955-83-9
Catalog No.: WLZ1608
Purity: 95%
MF: C16H12O
MW: 220.271
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C=1OC(=CC1)C1=CC=CC=C1
Catalog No.: WLZ1608
Purity: 95%
MF: C16H12O
MW: 220.271
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C=1OC(=CC1)C1=CC=CC=C1
CAS NO.: 955-83-9; 2,5-diphenylfuran. PROPERTIES: This aromatic heterocycle features two phenyl groups attached to a furan ring, creating a molecule with potential applications in organic synthesis and materials science. The 2,5-diphenylfuran typically appears as a white to off-white crystalline solid with moderate solubility in common organic solvents. Its molecular structure includes a conjugated furan ring that contributes to its characteristic absorption in the ultraviolet region. For optimal stability and to prevent degradation, this compound should be stored at 2-8 degree Celsius in a tightly sealed container under anhydrous conditions. When handling, appropriate safety measures including nitrile gloves and safety goggles are essential. This compound is sensitive to moisture and may hydrolyze in aqueous environments. In case of accidental spillage, clean the area with a damp cloth and dispose of materials according to local regulations. APPLICATIONS: The 2,5-diphenylfuran serves as a valuable intermediate in the synthesis of highly substituted furan derivatives and materials with specific electronic properties. The phenyl substituents provide handles for further functionalization through reactions such as oxidation or alkylation. In materials science, this compound functions as a building block for creating polymers and small molecules with applications in organic electronics and optoelectronics. Additionally, the molecule finds utility in chemical biology studies where its unique electronic properties can be harnessed for developing novel imaging agents and sensors. Researchers utilizing this compound benefit from its defined substitution pattern, enabling the development of advanced materials with tailored electronic and optical characteristics.
Reviews
Write Your Own Review