tert-butyl N-(azetidin-3-ylmethyl)-N-methylcarbamate hydrochloride
$295.00
CAS No.: 1170019-97-2
Catalog No.: 171560
Purity: 95%
MF: C10H21ClN2O2
MW: 236.743
Storage: 2-8 degree Celsius
SMILES: Cl.CN(CC1CNC1)C(=O)OC(C)(C)C
Catalog No.: 171560
Purity: 95%
MF: C10H21ClN2O2
MW: 236.743
Storage: 2-8 degree Celsius
SMILES: Cl.CN(CC1CNC1)C(=O)OC(C)(C)C
tert-butyl N-(azetidin-3-ylmethyl)-N-methylcarbamate hydrochloride; CAS No.: 1170019-97-2; tert-butyl N-(azetidin-3-ylmethyl)-N-methylcarbamate hydrochloride is a building block for drug discovery provided by ChemShuttle, a chemical online mall. It is used in CRO chemical synthesis, facilitating the exploration of new drug candidates. This compound can be incorporated into larger molecules, potentially leading to the development of novel drugs that can address various health issues.
Reviews
Write Your Own Review