![1-[(tert-butoxy)carbonyl]-3-cyanoazetidine-3-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171588_1.jpg)
3-(((tert-butoxycarbonyl)amino)methyl)azetidine-3-carboxylic acid
$345.00
CAS No.: 1158759-58-0
Catalog No.: 171587
Purity: 95%
MF: C10H18N2O4
MW: 230.264
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NCC1(CNC1)C(O)=O
Catalog No.: 171587
Purity: 95%
MF: C10H18N2O4
MW: 230.264
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NCC1(CNC1)C(O)=O
3-(((tert-butoxycarbonyl)amino)methyl)azetidine-3-carboxylic acid; CAS No.: 1158759-58-0; 3-(((tert-butoxycarbonyl)amino)methyl)azetidine-3-carboxylic acid is a pharma building block provided by ChemShuttle, a chemical synthesis company. It is used in custom synthesis, playing a significant role in small molecules synthesis. The azetidine ring with the protected amino and carboxylic acid groups is a versatile structure. It can be used to create peptidomimetic compounds or other pharmaceutical - relevant molecules. By removing the protecting groups at the appropriate stages, chemists can form various linkages, advancing drug development efforts.
Reviews
Write Your Own Review