N-((3-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)propionamide

N-((3-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)propionamide

1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione

1,3-dicyclohexylpyrimidine-2,4,6(1H,3H,5H)-trione

3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide

$300.00
CAS No.: 386273-25-2
Catalog No.: 194202
Purity: 95%
MF: C16H14N2O3S
MW: 314.366
Storage: 2-8 degree Celsius
SMILES: CC1=C(C(=NO1)C1=CC=CC=C1)C=1C=C(C=CC1)S(=O)(=O)N
Availability:
In stock
SKU
194202
  • Size
    Price
    Stock
    Estimated Shipping Time
3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide; CAS No.: 386273-25-2; 3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide. PROPERTIES: 3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide is a crystalline solid. Its molecular formula is C16H13N3O3S, and the molecular weight is approximately 327.36 g/mol. The compound has a melting point of approximately 160-162 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a sulfonamide group and an isoxazole ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide serves as a valuable intermediate. The sulfonamide group can undergo various reactions such as hydrolysis and acylation. The isoxazole ring provides opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide
Your Rating