N-((4-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)isobutyramide

N-((4-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)isobutyramide

1-propylpiperidin-4-amine dihydrochloride

1-propylpiperidin-4-amine dihydrochloride

ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate

$200.00
CAS No.: 1884279-18-8
Catalog No.: 194208
Purity: 95%
MF: C18H17NO4S
MW: 343.404
Storage: 2-8 degree Celsius
SMILES: CC1=C(C(=NO1)C1=CC=CC=C1)C1=CC=C(C=C1)S(=O)(=O)OCC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194208
  • Size
    Price
    Stock
    Estimated Shipping Time
ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate; CAS No.: 1884279-18-8; ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate. PROPERTIES: ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate is a crystalline solid. Its molecular formula is C19H18N2O4S, and the molecular weight is approximately 370.42 g/mol. The compound has a melting point of approximately 130-132 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a sulfonate group and an isoxazole ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate serves as a versatile intermediate. The sulfonate group can undergo various reactions such as hydrolysis and alkylation. The isoxazole ring provides opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:ethyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate
Your Rating