1,4-bis((1H-imidazol-1-yl)methyl)benzene

1,4-bis((1H-imidazol-1-yl)methyl)benzene

3,5-dimethyl-4-nitroisoxazole

3,5-dimethyl-4-nitroisoxazole

2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate

$300.00
CAS No.: 150321-92-9
Catalog No.: 194916
Purity: 95%
MF: C15H11NO7
MW: 317.253
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C2C=C(C(OC2=C1)=O)C(=O)ON1C(CCC1=O)=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194916
  • Size
    Price
    Stock
    Estimated Shipping Time
2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate; CAS No.: 150321-92-9; 2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate. PROPERTIES: 2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate is a crystalline solid. Its molecular formula is C14H10N2O6, and the molecular weight is approximately 318.24 g/mol. The compound has a melting point of approximately 130-132 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a pyrrolidine ring, a chromene ring, and multiple oxygen atoms, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, this compound serves as a valuable intermediate. The pyrrolidine ring provides opportunities for further functionalization. The chromene ring offers unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of 2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate
Your Rating