4-chloro-2-(methylthio)-5-pyrimidinecarboxylic acid

4-chloro-2-(methylthio)-5-pyrimidinecarboxylic acid

2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate

2,5-dioxopyrrolidin-1-yl 7-methoxy-2-oxo-2H-chromene-3-carboxylate

1,4-bis((1H-imidazol-1-yl)methyl)benzene

$300.00
CAS No.: 56643-83-5
Catalog No.: 194917
Purity: 95%
MF: C14H14N4
MW: 238.294
Storage: 2-8 degree Celsius
SMILES: N1(C=NC=C1)CC1=CC=C(C=C1)CN1C=NC=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194917
  • Size
    Price
    Stock
    Estimated Shipping Time
1,4-bis((1H-imidazol-1-yl)methyl)benzene; CAS No.: 56643-83-5; 1,4-bis((1H-imidazol-1-yl)methyl)benzene. PROPERTIES: 1,4-bis((1H-imidazol-1-yl)methyl)benzene is a crystalline solid. Its molecular formula is C14H14N4, and the molecular weight is approximately 250.29 g/mol. The compound has a melting point of approximately 140-142 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing two imidazole rings and a benzene ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 1,4-bis((1H-imidazol-1-yl)methyl)benzene serves as a versatile intermediate. The imidazole rings provide opportunities for various reactions such as alkylation and acylation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antifungal drugs, the structure of 1,4-bis((1H-imidazol-1-yl)methyl)benzene can be modified to enhance the drug's antifungal activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:1,4-bis((1H-imidazol-1-yl)methyl)benzene
Your Rating