3-bromo-5-(trifluoromethoxy)benzoic acid
$200.00
CAS No.: 453565-90-7
Catalog No.: WLZ1704
Purity: 95%
MF: C8H4BrF3O3
MW: 285.015
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=O)O)C=C(C1)OC(F)(F)F
Catalog No.: WLZ1704
Purity: 95%
MF: C8H4BrF3O3
MW: 285.015
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=O)O)C=C(C1)OC(F)(F)F
CAS NO.: 453565-90-7; 3-bromo-5-(trifluoromethoxy)benzoic acid. PROPERTIES: This halogenated aromatic carboxylic acid features a bromine atom and a trifluoromethoxy group on a benzene ring connected to a carboxylic acid group, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The 3-bromo-5-(trifluoromethoxy)benzoic acid typically appears as a white to off-white crystalline solid with moderate solubility in common organic solvents. Its molecular structure includes electron-withdrawing trifluoromethoxy and bromine groups that influence the electronic properties of the aromatic system. For optimal stability and to prevent degradation, this compound should be stored at 2-8 degree Celsius in a tightly sealed container under anhydrous conditions. When handling, appropriate safety measures including nitrile gloves and safety goggles are essential. This compound is sensitive to moisture and may hydrolyze in aqueous environments. In case of accidental spillage, clean the area with a damp cloth and dispose of materials according to local regulations. APPLICATIONS: The 3-bromo-5-(trifluoromethoxy)benzoic acid serves as a valuable intermediate in the synthesis of highly functionalized aromatic compounds and materials with specific electronic properties. The carboxylic acid group provides a handle for further functionalization through reactions such as esterification or amidation. In medicinal chemistry, this compound functions as a building block for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The trifluoromethoxy and bromine substituents contribute to target binding affinity and selectivity. Additionally, the molecule finds utility in materials science as a monomer for creating polymers with specific electronic and optical properties. Researchers utilizing this compound benefit from its defined substitution pattern, enabling the development of advanced materials with tailored electronic characteristics.
Reviews
Write Your Own Review