2-bromo-2'-difluoromethoxyacetophenone
$200.00
CAS No.: 405921-09-7
Catalog No.: 193890
Purity: 95%
MF: C9H7BrF2O2
MW: 265.053
Storage: 2-8 degree Celsius
SMILES: BrCC(=O)C1=C(C=CC=C1)OC(F)F
Catalog No.: 193890
Purity: 95%
MF: C9H7BrF2O2
MW: 265.053
Storage: 2-8 degree Celsius
SMILES: BrCC(=O)C1=C(C=CC=C1)OC(F)F
2-bromo-2'-difluoromethoxyacetophenone; CAS No.: 405921-09-7;2-bromo-2'-difluoromethoxyacetophenone. PROPERTIES: 2-bromo-2'-difluoromethoxyacetophenone is a brominated and fluorinated aromatic ketone with molecular formula C10H8BrF2O2. It typically exists as a colorless to pale yellow liquid with a boiling point around 160-165 C. The compound has limited water solubility but dissolves well in organic solvents like dichloromethane or THF. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic bromine vapors. Proper storage involves keeping it in tightly sealed containers below 30 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a versatile building block for creating complex aromatic systems. The bromo substituent enables cross-coupling reactions to form biaryl structures, while the difluoromethoxy and ketone groups offer additional functionality for further elaboration (Tetrahedron Letters). In pharmaceutical development, 2-bromo-2'-difluoromethoxyacetophenone contributes to the synthesis of antimicrobial agents where the halogenated aromatic scaffold enhances binding to microbial targets (Antimicrobial Agents and Chemotherapy). The compound also finds application in materials science as a building block for organic electronics, where its electron-withdrawing bromine and fluorine atoms modulate the electronic properties of derived materials (Journal of Materials Chemistry C).
Reviews
Write Your Own Review