Fmoc-Sar-OH
$250.00
CAS No.: 77128-70-2
Catalog No.: 196617
Purity: 95%
MF: C18H17NO4
MW: 311.337
Storage: 2-8 degree Celsius
SMILES: C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)N(CC(=O)O)C
Catalog No.: 196617
Purity: 95%
MF: C18H17NO4
MW: 311.337
Storage: 2-8 degree Celsius
SMILES: C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)N(CC(=O)O)C
Fmoc-Sar-OH; N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-methylglycine; CAS No.: 77128-70-2; Fmoc-Sar-OH. PROPERTIES: Fmoc-Sar-OH is a protected amino acid derivative used in peptide synthesis. This compound has a molecular weight of 277.30 g/mol and appears as a white to off-white solid. It demonstrates limited water solubility but is soluble in common organic solvents. Fmoc-Sar-OH should be stored at room temperature in a dry, dark environment. It is sensitive to moisture and light. Safety considerations include potential eye and skin irritation, so protective measures are advised. APPLICATIONS: Fmoc-Sar-OH serves as a building block in the synthesis of peptides containing sarcosine (N-methylglycine) residues. In medicinal chemistry, it facilitates the creation of peptidomimetics with increased metabolic stability due to the N-methyl group. In research applications, Fmoc-Sar-OH is used to prepare peptides for studying protein-protein interactions where steric hindrance and hydrophobicity play roles. These applications are detailed in peptide synthesis protocols and medicinal chemistry literature.
Reviews
Write Your Own Review