ethyl 2-((ethoxycarbonothioyl)thio)propanoate

ethyl 2-((ethoxycarbonothioyl)thio)propanoate

2-chloro-N-(methylsulfonyl)acetamide

2-chloro-N-(methylsulfonyl)acetamide

ethyl 2-amino-4,4-difluoro-3-oxobutanoate hydrochloride

$300.00
CAS No.: 1651167-45-1
Catalog No.: 194560
Purity: 95%
MF: C6H10ClF2NO3
MW: 217.599
Storage: 2-8 degree Celsius
SMILES: NC(C(OCC)=O)C(C(F)F)=O.Cl
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194560
  • Size
    Price
    Stock
    Estimated Shipping Time
ethyl 2-amino-4,4-difluoro-3-oxobutanoate hydrochloride; CAS No.: 1651167-45-1; ethyl 2-amino-4,4-difluoro-3-oxobutanoate hydrochloride. PROPERTIES: ethyl 2-amino-4,4-difluoro-3-oxobutanoate hydrochloride is a crystalline solid. Its molecular formula is C6H10F2N2O3 {HCl, and the molecular weight is approximately 237.62 g/mol. The compound has a melting point of approximately 130-132 C. It is moderately soluble in water and commonly used in the form of its hydrochloride salt. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group, a ketone group, two fluorine atoms, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, ethyl 2-amino-4,4-difluoro-3-oxobutanoate serves as a valuable intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The ketone group can be converted to other functional groups such as alcohol or amine. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of ethyl 2-amino-4,4-difluoro-3-oxobutanoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:ethyl 2-amino-4,4-difluoro-3-oxobutanoate hydrochloride
Your Rating