Ac-D-Glu-OH
$300.00
CAS No.: 19146-55-5
Catalog No.: 196772
Purity: 95%
MF: C7H11NO5
MW: 189.167
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)N[C@@H](C(=O)O)CCC(=O)O
Catalog No.: 196772
Purity: 95%
MF: C7H11NO5
MW: 189.167
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)N[C@@H](C(=O)O)CCC(=O)O
Ac-D-Glu-OH; (R)-2-acetamidopentanedioic acid; CAS No.: 19146-55-5; Ac-D-Glu-OH. PROPERTIES: Ac-D-Glu-OH is a protected amino acid derivative used in peptide synthesis. This compound has a molecular weight of approximately 257.26 g/mol and appears as a white to off-white solid. It demonstrates limited water solubility but dissolves in common organic solvents. Ac-D-Glu-OH should be stored at room temperature in a dry, dark environment. It is sensitive to moisture and light. Safety considerations include potential eye and skin irritation, so protective measures are advised. APPLICATIONS: Ac-D-Glu-OH serves as a building block in the synthesis of peptides containing D-glutamic acid residues with acetyl protection on the amino group. In medicinal chemistry, it facilitates the creation of peptidomimetics with enhanced metabolic stability. In research applications, Ac-D-Glu-OH is used to prepare peptides for studying protein-protein interactions and enzyme recognition. These applications are detailed in peptide chemistry literature and synthetic organic chemistry publications.
Reviews
Write Your Own Review