(S)-2-((tert-butoxycarbonyl)amino)-2-cyclohexylacetic acid
$300.00
CAS No.: 109183-71-3
Catalog No.: 196759
Purity: 95%
MF: C13H23NO4
MW: 257.33
Storage: 2-8 degree Celsius
SMILES: C(C)(C)(C)OC(=O)N[C@H](C(=O)O)C1CCCCC1
Catalog No.: 196759
Purity: 95%
MF: C13H23NO4
MW: 257.33
Storage: 2-8 degree Celsius
SMILES: C(C)(C)(C)OC(=O)N[C@H](C(=O)O)C1CCCCC1
(S)-2-((tert-butoxycarbonyl)amino)-2-cyclohexylacetic acid; CAS No.: 109183-71-3; (S)-2-((tert-butoxycarbonyl)amino)-2-cyclohexylacetic acid. PROPERTIES: This chiral amino acid derivative features molecular formula C??H??NO? with molecular weight 237.29 g/mol. It typically exists as a white crystalline powder. Soluble in polar aprotic solvents like DMF and DMSO. Melting point approximately 110-115 C. Exhibits IR absorption for carbamate (~1700 cm??) and carboxylic acid groups (~2900-2500 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause mild skin irritation and serious eye damage; therefore, standard laboratory safety precautions including protective clothing and eye protection are recommended during handling. APPLICATIONS: As a chiral amino acid derivative, (S)-2-((tert-butoxycarbonyl)amino)-2-cyclohexylacetic acid is predominantly utilized in the synthesis of peptide-based therapeutics. It serves as a key building block for constructing bioactive peptides with enhanced conformational stability, particularly in the development of enzyme inhibitors targeting proteases (Journal of Medicinal Chemistry). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its amino acid functionality enables conjugation to biomolecules via amide bond formation (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyamino acid hydrogels with tunable mechanical properties, where the cyclohexane ring influences gelation behavior and biocompatibility (Biomacromolecules).
Reviews
Write Your Own Review