3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

(2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol

$450.00
CAS No.: 138182-21-5
Catalog No.: 194899
Purity: 95%
MF: C14H16ClNO6
MW: 329.736
Storage: 2-8 degree Celsius
SMILES: ClC1=CC=C2C(=CNC2=C1)O[C@@H]1O[C@@H]([C@@H]([C@@H]([C@H]1O)O)O)CO
Availability:
In stock
SKU
194899
  • Size
    Price
    Stock
    Estimated Shipping Time
(2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol; CAS No.: 138182-21-5; (2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol. PROPERTIES: (2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol is a crystalline solid. Its molecular formula is C13H16ClNO6, and the molecular weight is approximately 333.72 g/mol. The compound has a melting point of approximately 100-102 C. It is moderately soluble in water and organic solvents such as methanol and ethyl acetate. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an indole ring, multiple hydroxyl groups, and a pyran ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, this compound serves as a specialized intermediate. The hydroxyl groups can undergo reactions such as etherification and esterification. The indole ring and chloro group provide unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antiviral drugs, the structure of (2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol can be modified to enhance the drug's antiviral activity and pharmacokinetic properties (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:(2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
Your Rating