(2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol

(2S,3R,4S,5R,6R)-2-((6-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol

2-(4-fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

2-(4-fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

$150.00
CAS No.: 863868-36-4
Catalog No.: 194900
Purity: 95%
MF: C12H15BF2O2
MW: 240.058
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C=C(C1)F)B1OC(C(O1)(C)C)(C)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194900
  • Size
    Price
    Stock
    Estimated Shipping Time
2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane; CAS No.: 863868-36-4; 2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. PROPERTIES: 2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a crystalline solid. Its molecular formula is C12H15BF2O3, and the molecular weight is approximately 269.06 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a dioxaborolane ring and a difluorophenyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, this compound serves as a valuable intermediate. The dioxaborolane ring provides opportunities for Suzuki coupling reactions. The difluorophenyl group offers specific electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Your Rating