ethyl 9-bromononanoate

ethyl 9-bromononanoate

methyl 4-acetamido-3-bromo-2-(2-bromoethoxy)-5-chlorobenzoate

methyl 4-acetamido-3-bromo-2-(2-bromoethoxy)-5-chlorobenzoate

2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide

$200.00
CAS No.: 24522-30-3
Catalog No.: 194180
Purity: 95%
MF: C10H7F3N2O
MW: 228.173
Storage: 2-8 degree Celsius
SMILES: C(#N)CC(=O)NC1=CC=C(C=C1)C(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194180
  • Size
    Price
    Stock
    Estimated Shipping Time
2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide; CAS No.: 24522-30-3; 2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide. PROPERTIES: 2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide is a crystalline solid. Its molecular formula is C11H8F3N2O, and the molecular weight is approximately 241.20 g/mol. The compound has a melting point of approximately 140-142 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a cyano group, an amide group, and a trifluoromethyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide serves as a versatile intermediate. The cyano group can be converted to other functional groups such as carboxylic acid or amine. The amide group can undergo reactions such as hydrolysis and acylation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of 2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-cyano-N-(4-(trifluoromethyl)phenyl)acetamide
Your Rating