7-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline
$300.00
CAS No.: 450-62-4
Catalog No.: 190243
Purity: 95%
MF: C10H10F3N
MW: 201.191
Storage: 2-8 degree Celsius
SMILES: FC(C1=CC=C2CCCNC2=C1)(F)F
Catalog No.: 190243
Purity: 95%
MF: C10H10F3N
MW: 201.191
Storage: 2-8 degree Celsius
SMILES: FC(C1=CC=C2CCCNC2=C1)(F)F
7-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline; CAS No.: 450-62-4; 7-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline is part of Chem Shuttle's collection of trifluoromethyl-substituted quinolines that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing quinoline derivatives with trifluoromethyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its trifluoromethyl group, serves as a valuable building block for the synthesis of bioactive molecules with specific spatial configurations. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 7-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review