7-(difluoromethyl)-6-(1-methyl-1H-pyrazol-4-yl)-1,2,3,4-tetrahydroquinoline
$480.00
CAS No.: 1904651-39-3
Catalog No.: 190237
Purity: 95%
MF: C14H15F2N3
MW: 263.291
Storage: 2-8 degree Celsius
SMILES: FC(C1=C(C=C2CCCNC2=C1)C=1C=NN(C1)C)F
Catalog No.: 190237
Purity: 95%
MF: C14H15F2N3
MW: 263.291
Storage: 2-8 degree Celsius
SMILES: FC(C1=C(C=C2CCCNC2=C1)C=1C=NN(C1)C)F
7-(difluoromethyl)-6-(1-methyl-1H-pyrazol-4-yl)-1,2,3,4-tetrahydroquinoline; CAS No.: 1904651-39-3; 7-(difluoromethyl)-6-(1-methyl-1H-pyrazol-4-yl)-1,2,3,4-tetrahydroquinoline exemplifies the difluoromethyl-substituted quinolines category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to quinoline derivatives with difluoromethyl and pyrazolyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its difluoromethyl and pyrazolyl groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that 7-(difluoromethyl)-6-(1-methyl-1H-pyrazol-4-yl)-1,2,3,4-tetrahydroquinoline is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review