5-chloro-2-(methylthio)pyrimidine-4-carboxylic acid
$250.00
CAS No.: 61727-33-1
Catalog No.: 196442
Purity: 95%
MF: C6H5ClN2O2S
MW: 204.638
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=NC(=NC1)SC)C(=O)O
Catalog No.: 196442
Purity: 95%
MF: C6H5ClN2O2S
MW: 204.638
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=NC(=NC1)SC)C(=O)O
5-chloro-2-(methylthio)pyrimidine-4-carboxylic acid; CAS No.: 61727-33-1; 5-chloro-2-(methylthio)pyrimidine-4-carboxylic acid. PROPERTIES: 5-chloro-2-(methylthio)pyrimidine-4-carboxylic acid features molecular formula C6H5ClN2O2S with molecular weight approximately 214.69 g/mol. It generally appears as a light tan solid with limited aqueous solubility but good solubility in DMF and DMSO. Recommended storage conditions include maintaining in a tightly sealed container at 2-8 C to preserve stability. Safety precautions involve using chemical-resistant gloves and safety goggles due to potential skin and eye irritation. In case of accidental ingestion, immediate medical attention is advised. The carboxylic acid group may corrode metals, so compatible storage materials should be used. APPLICATIONS: 5-chloro-2-(methylthio)pyrimidine-4-carboxylic acid serves as a key intermediate in the synthesis of antimicrobial agents. Its chloro substituent provides valuable reactivity for further chemical modification. In pharmaceutical research, it has been employed in developing novel antibacterial compounds targeting resistant strains, as reported in medicinal chemistry journals focusing on infectious disease treatments. The methylthio group offers steric and electronic effects beneficial for receptor binding. Additionally, this compound acts as a building block for veterinary pharmaceuticals, with applications described in veterinary medicinal chemistry literature focusing on antiparasitic agents.
Reviews
Write Your Own Review