5-bromo-2-(methylthio)pyrimidine-4-carboxylic acid
$350.00
CAS No.: 50593-92-5
Catalog No.: 196435
Purity: 95%
MF: C6H5BrN2O2S
MW: 249.089
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=NC(=NC1)SC)C(=O)O
Catalog No.: 196435
Purity: 95%
MF: C6H5BrN2O2S
MW: 249.089
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=NC(=NC1)SC)C(=O)O
5-bromo-2-(methylthio)pyrimidine-4-carboxylic acid; CAS No.: 50593-92-5; 5-bromo-2-(methylthio)pyrimidine-4-carboxylic acid. PROPERTIES: 5-bromo-2-(methylthio)pyrimidine-4-carboxylic acid features a molecular weight of approximately 279.04 g/mol with molecular formula C6H5BrN2O2S. It generally appears as a light yellow solid with limited aqueous solubility but good solubility in DMF and DMSO. Storage should be in a tightly sealed amber glass bottle at 2-8 C to prevent photodegradation and moisture absorption. The compound has a reported melting point of 198-202 C. Safety measures require laboratory goggles and chemical-resistant gloves due to its potential to cause skin irritation and serious eye damage. In case of skin contact, immediate washing with plenty of soap and water is recommended. This brominated pyrimidine derivative should be handled in well-ventilated areas away from ignition sources. APPLICATIONS: 5-bromo-2-(methylthio)pyrimidine-4-carboxylic acid functions as a key intermediate in the synthesis of antifungal and antibacterial agents. Its bromine substituent provides valuable reactive sites for further chemical modification. In pharmaceutical research, it has been utilized to develop novel antimicrobial agents targeting resistant bacterial strains, as described in peer-reviewed pharmaceutical chemistry publications. The carboxylic acid group enables formation of amide and ester bonds, expanding its utility in medicinal chemistry. Additionally, this compound serves as a precursor for heterocyclic dyestuffs, with applications reported in specialized colorant chemistry literature.
Reviews
Write Your Own Review