![(1S)-2-methyl-1-[4-(trifluoromethyl)phenyl]propylamine hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/189603_1.jpg)
5-bromo-2,4-dichloro-6-(trifluoromethyl)pyrimidine
$300.00
CAS No.: 1240622-62-1
Catalog No.: 190846
Purity: 95%
MF: C5BrCl2F3N2
MW: 295.873
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=NC(=NC1C(F)(F)F)Cl)Cl
Catalog No.: 190846
Purity: 95%
MF: C5BrCl2F3N2
MW: 295.873
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=NC(=NC1C(F)(F)F)Cl)Cl
5-bromo-2,4-dichloro-6-(trifluoromethyl)pyrimidine; CAS No.: 1240622-62-1; 5-bromo-2,4-dichloro-6-(trifluoromethyl)pyrimidine is a valuable member of ChemShuttle's library of compounds, particularly useful as a building block in the synthesis of pharmaceuticals and agrochemicals. This pyrimidine derivative combines bromination, dichlorination, and trifluoromethylation, offering multiple points of diversity for further chemical modification. ChemShuttle's role as a custom chemical synthesis company is highlighted by their ability to produce 5-bromo-2,4-dichloro-6-(trifluoromethyl)pyrimidine (CAS No.: 1240622-62-1) with consistent quality and reliability. As a leading chemicals distributor, ChemShuttle ensures the availability of this compound to research institutions and industrial laboratories worldwide. Their expertise in blocks chemistry ensures that researchers have access to high-quality intermediates essential for advancing chemical research and development across multiple disciplines, from medicinal chemistry to materials science.
Reviews
Write Your Own Review