4-methoxy-2-(trifluoromethyl)benzoic acid
$250.00
CAS No.: 127817-85-0
Catalog No.: 190412
Purity: 95%
MF: C9H7F3O3
MW: 220.146
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=C(C(=O)O)C=C1)C(F)(F)F
Catalog No.: 190412
Purity: 95%
MF: C9H7F3O3
MW: 220.146
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=C(C(=O)O)C=C1)C(F)(F)F
4-methoxy-2-(trifluoromethyl)benzoic acid; CAS No.: 127817-85-0; 4-methoxy-2-(trifluoromethyl)benzoic acid. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including 4-methoxy-2-(trifluoromethyl)benzoic acid (CAS No.: 127817-85-0). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review