3-methyl-5-nitrophenol
$250.00
CAS No.: 127818-58-0
Catalog No.: 190413
Purity: 95%
MF: C7H7NO3
MW: 153.137
Storage: 2-8 degree Celsius
SMILES: CC=1C=C(C=C(C1)[N+](=O)[O-])O
Catalog No.: 190413
Purity: 95%
MF: C7H7NO3
MW: 153.137
Storage: 2-8 degree Celsius
SMILES: CC=1C=C(C=C(C1)[N+](=O)[O-])O
3-methyl-5-nitrophenol; CAS No.: 127818-58-0; 3-methyl-5-nitrophenol. ChemShuttle, a leading chemical online store, provides a wide range of chemical building blocks such as 3-methyl-5-nitrophenol (CAS No.: 127818-58-0). This compound is a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The company s custom chemical synthesis services allow for the production of such specialized compounds, catering to the unique requirements of researchers and industries. As a worldwide chemical supplier, ChemShuttle ensures the availability of high-quality chemical building blocks like 3-methyl-5-nitrophenol, supporting advancements in chemical research and drug discovery.
Reviews
Write Your Own Review