4-fluoro-5-nitro-2-methylbenzonitrile
$250.00
CAS No.: 932375-18-3
Catalog No.: 194067
Purity: 95%
MF: C8H5FN2O2
MW: 180.138
Storage: 2-8 degree Celsius
SMILES: FC1=CC(=C(C#N)C=C1[N+](=O)[O-])C
Catalog No.: 194067
Purity: 95%
MF: C8H5FN2O2
MW: 180.138
Storage: 2-8 degree Celsius
SMILES: FC1=CC(=C(C#N)C=C1[N+](=O)[O-])C
4-fluoro-5-nitro-2-methylbenzonitrile; CAS No.: 932375-18-3; 4-fluoro-5-nitro-2-methylbenzonitrile. PROPERTIES: 4-fluoro-5-nitro-2-methylbenzonitrile is a crystalline solid. Its molecular formula is C8H5FNO3, with a molecular weight of 190.13 g/mol. The compound has a melting point of around 72-74 C. It is moderately soluble in common organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but has limited solubility in water. Proper storage conditions involve keeping it in a tightly sealed container in a cool, dry place, preferably below 20 C, away from direct sunlight and sources of heat. For safe handling, protective gloves, eye protection, and a lab coat should be worn. In case of accidental contact with skin or eyes, immediate rinsing with plenty of water is necessary. Inhalation of dust should be avoided, and in case of accidental inhalation, fresh air should be provided. APPLICATIONS: In the chemical synthesis field, 4-fluoro-5-nitro-2-methylbenzonitrile serves as a valuable intermediate for the preparation of more complex organic compounds. The nitro group can be reduced to an amine group, enabling further functionalization. The fluorine atom provides an opportunity for selective reactions, making it applicable in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. For example, in the development of novel antimicrobial agents, the unique substituents of 4-fluoro-5-nitro-2-methylbenzonitrile can be utilized to design compounds with enhanced bioactivity (as described in organic synthesis journals focusing on heterocyclic compounds). Additionally, in materials science, it can be incorporated into the synthesis of functional polymers or liquid crystals, where the combination of fluorine and cyano groups can influence the material's electronic and optical properties (as mentioned in polymer chemistry research papers).
Reviews
Write Your Own Review