4-bromo-2,5-difluorophenylacetic acid
$180.00
CAS No.: 871035-64-2
Catalog No.: 190080
Purity: 95%
MF: C8H5BrF2O2
MW: 251.026
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=C(C=C1F)CC(=O)O)F
Catalog No.: 190080
Purity: 95%
MF: C8H5BrF2O2
MW: 251.026
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=C(C=C1F)CC(=O)O)F
4-bromo-2,5-difluorophenylacetic acid; CAS No.: 871035-64-2; 4-bromo-2,5-difluorophenylacetic acid is part of Chem Shuttle's offering of bromodifluorophenylacetic acids that serve as key intermediates in organic synthesis. As a chemical online store, Chem Shuttle provides access to acetic acid derivatives with bromo and fluoro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its bromo and difluoro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized bromodifluorophenylacetic acids to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 4-bromo-2,5-difluorophenylacetic acid, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review