3-(1-aminoethyl)-5-(trifluoromethyl)aniline
$399.00
CAS No.: 1337374-96-5
Catalog No.: 190074
Purity: 95%
MF: C9H11F3N2
MW: 204.195
Storage: 2-8 degree Celsius
SMILES: NC(C)C=1C=C(N)C=C(C1)C(F)(F)F
Catalog No.: 190074
Purity: 95%
MF: C9H11F3N2
MW: 204.195
Storage: 2-8 degree Celsius
SMILES: NC(C)C=1C=C(N)C=C(C1)C(F)(F)F
3-(1-aminoethyl)-5-(trifluoromethyl)aniline; CAS No.: 1337374-96-5; 3-(1-aminoethyl)-5-(trifluoromethyl)aniline belongs to Chem Shuttle's collection of aminotrifluoromethyl-substituted anilines that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing aniline derivatives with amino and trifluoromethyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its amino and trifluoromethyl groups, serves as a valuable building block for the synthesis of bioactive molecules with specific spatial configurations. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 3-(1-aminoethyl)-5-(trifluoromethyl)aniline is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review