(4-(benzyloxy)phenyl)methanol
$200.00
CAS No.: 836-43-1
Catalog No.: 190740
Purity: 95%
MF: C14H14O2
MW: 214.264
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC1=CC=C(C=C1)CO
Catalog No.: 190740
Purity: 95%
MF: C14H14O2
MW: 214.264
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC1=CC=C(C=C1)CO
(4-(benzyloxy)phenyl)methanol; CAS No.: 836-43-1; (4-(benzyloxy)phenyl)methanol is a specialized chem block offered by ChemShuttle, a reputable chemical synthesis company focused on providing essential intermediates for advanced chemical research. This ether-containing aromatic alcohol derivative serves as a versatile starting material in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. ChemShuttle's inventory of building blocks chemistry includes numerous benzyl alcohol derivatives like (4-(benzyloxy)phenyl)methanol (CAS No.: 836-43-1), which are critical for forming carbon-oxygen bonds through glycosylation or etherification reactions. As a custom chemical synthesis company, ChemShuttle can produce this compound in various quantities, meeting specific purity requirements for diverse applications. Their online platform simplifies the procurement process, allowing researchers to access high-quality (4-(benzyloxy)phenyl)methanol and other key intermediates essential for advancing chemical research and development.
Reviews
Write Your Own Review