2-chloro-6-nitrotoluene
$200.00
CAS No.: 83-42-1
Catalog No.: 190739
Purity: 95%
MF: C7H6ClNO2
MW: 171.583
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C)C(=CC=C1)[N+](=O)[O-]
Catalog No.: 190739
Purity: 95%
MF: C7H6ClNO2
MW: 171.583
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C)C(=CC=C1)[N+](=O)[O-]
2-chloro-6-nitrotoluene; CAS No.: 83-42-1; 2-chloro-6-nitrotoluene is part of ChemShuttle's comprehensive library of cycle compounds, serving as a valuable building block in organic synthesis and drug discovery. This chlorinated nitrotoluene derivative combines electron-withdrawing and donating groups, offering unique reactivity profiles valuable in constructing complex molecules. ChemShuttle's role as a custom chemical synthesis company is highlighted by their ability to produce 2-chloro-6-nitrotoluene (CAS No.: 83-42-1) with consistent quality and reliability. As a leading chemicals distributor, ChemShuttle ensures the availability of this compound to research institutions and pharmaceutical companies globally. Their expertise in blocks chemistry ensures that researchers have access to high-quality intermediates essential for advancing chemical research and development across multiple disciplines, from medicinal chemistry to materials science.
Reviews
Write Your Own Review