4-amino-1-[(benzyloxy)carbonyl]piperidine-4-carboxylic acid
$195.00
CAS No.: 115655-41-9
Catalog No.: 171597
Purity: 95%
MF: C14H18N2O4
MW: 278.308
Storage: 2-8 degree Celsius
SMILES: NC1(CCN(CC1)C(=O)OCC1=CC=CC=C1)C(O)=O
Catalog No.: 171597
Purity: 95%
MF: C14H18N2O4
MW: 278.308
Storage: 2-8 degree Celsius
SMILES: NC1(CCN(CC1)C(=O)OCC1=CC=CC=C1)C(O)=O
4-amino-1-[(benzyloxy)carbonyl]piperidine-4-carboxylic acid; CAS No.: 115655-41-9; 4-amino-1-[(benzyloxy)carbonyl]piperidine-4-carboxylic acid is a various organic chemicals product from ChemShuttle, a worldwide chemical supplier. It participates in CRO chemical synthesis, where it acts as an important intermediate in small molecules synthesis. The piperidine ring with the protected amino and carboxylic acid groups provides a platform for chemical modifications. It can be used to build more complex molecules by removing the protecting groups and forming various linkages, contributing to the development of new chemical entities.
Reviews
Write Your Own Review