![4-amino-1-[(benzyloxy)carbonyl]piperidine-4-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171597_1.jpg)
1-benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate
$195.00
CAS No.: 115655-42-0
Catalog No.: 171596
Purity: 95%
MF: C15H20N2O4
MW: 292.335
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1(N)CCN(CC1)C(=O)OCC1=CC=CC=C1
Catalog No.: 171596
Purity: 95%
MF: C15H20N2O4
MW: 292.335
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1(N)CCN(CC1)C(=O)OCC1=CC=CC=C1
1-benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate; CAS No.: 115655-42-0; 1-benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate is a building block for drug discovery offered by ChemShuttle, a leading chemicals distributor. It is involved in custom synthesis, playing a significant role in small molecules synthesis. The piperidine ring with the protected amino and ester groups is a versatile structure. It can be used to create molecules with specific conformations and functionalities, which are essential for drug development. By manipulating these protecting groups and the ring structure, chemists can design novel drug candidates.
Reviews
Write Your Own Review