Etoxazole

Etoxazole

(R)-2-(4-isopropyl-4,5-dihydrooxazol-2-yl)phenol

(R)-2-(4-isopropyl-4,5-dihydrooxazol-2-yl)phenol

4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate

$300.00
CAS No.: 1384956-50-6
Catalog No.: 194255
Purity: 95%
MF: C7H12F3NO4S2
MW: 295.304
Storage: 2-8 degree Celsius
SMILES: FC(S(=O)(=O)O)(F)F.CC1(N=C(OC1)SC)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194255
  • Size
    Price
    Stock
    Estimated Shipping Time
4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate; CAS No.: 1384956-50-6; 4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate. PROPERTIES: 4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate is a crystalline solid. Its molecular formula is C6H11F3N2O3S, and the molecular weight is approximately 266.23 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an oxazole ring, a methylthio group, and a trifluoromethanesulfonate group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate serves as a specialized intermediate. The trifluoromethanesulfonate group provides a site for substitution reactions. The oxazole ring and methylthio group offer unique electronic effects. In the chemical industry, derivatives of this compound can be explored as potential catalysts or intermediates for the synthesis of various organic compounds. For example, in the development of certain agrochemicals, the structure of 4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate can be utilized to design compounds with improved herbicidal activities (as mentioned in agrochemical chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4,4-dimethyl-2-(methylthio)-4,5-dihydrooxazole trifluoromethanesulfonate
Your Rating