4-(((2,5-dioxopyrrolidin-1-yl)oxy)carbonyl)-N,N,N-trimethylbenzenaminium trifluoromethanesulfonate
$450.00
CAS No.: 282092-02-8
Catalog No.: 185893
Purity: 95%
MF: C15H17F3N2O7S
MW: 426.369
Storage: -20 degree Celsius
SMILES: FC(S(=O)(=O)[O-])(F)F.O=C1N(C(CC1)=O)OC(=O)C1=CC=C(C=C1)[N+](C)(C)C
Catalog No.: 185893
Purity: 95%
MF: C15H17F3N2O7S
MW: 426.369
Storage: -20 degree Celsius
SMILES: FC(S(=O)(=O)[O-])(F)F.O=C1N(C(CC1)=O)OC(=O)C1=CC=C(C=C1)[N+](C)(C)C
4-(((2,5-dioxopyrrolidin-1-yl)oxy)carbonyl)-N,N,N-trimethylbenzenaminium trifluoromethanesulfonate,CAS No.: 282092-02-8: This compound is used in the synthesis of complex organic molecules. Its unique chemical structure and reactivity profile make it valuable in the production of fine chemicals and intermediates.
Reviews
Write Your Own Review