4-(4-bromophenyl)piperidine-4-carbonitrile
$195.00
CAS No.: 1255666-69-3
Catalog No.: 171963
Purity: 95%
MF: C12H13BrN2
MW: 265.154
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)C1(CCNCC1)C#N
Catalog No.: 171963
Purity: 95%
MF: C12H13BrN2
MW: 265.154
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)C1(CCNCC1)C#N
4-(4-bromophenyl)piperidine-4-carbonitrile; CAS No.: 1255666-69-3; 4-(4-bromophenyl)piperidine-4-carbonitrile is one of the chem blocks offered by ChemShuttle, a renowned worldwide chemical supplier. As a key intermediate in the realm of chemical synthesis, this compound plays a crucial role in various research and development processes. ChemShuttle, a leading chemical synthesis company, not only distributes a wide range of high-quality chemicals but also provides custom synthesis services. Their expertise in Small molecules synthesis ensures that customers can obtain 4-(4-bromophenyl)piperidine-4-carbonitrile and other compounds tailored to their specific needs, making it a reliable partner for those engaged in drug discovery and other chemical research endeavors.
Reviews
Write Your Own Review