3-bromo-5-chloro-4-fluoronitrobenzene
$360.00
CAS No.: 1330583-70-4
Catalog No.: 193988
Purity: 95%
MF: C6H2BrClFNO2
MW: 254.442
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=C(C1F)Cl)[N+](=O)[O-]
Catalog No.: 193988
Purity: 95%
MF: C6H2BrClFNO2
MW: 254.442
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=C(C1F)Cl)[N+](=O)[O-]
3-bromo-5-chloro-4-fluoronitrobenzene; CAS No.: 1330583-70-4;3-bromo-5-chloro-4-fluoronitrobenzene. PROPERTIES: 3-bromo-5-chloro-4-fluoronitrobenzene is a brominated, chlorinated, and fluorinated aromatic nitro compound with molecular formula C6H3BrClFNO2. It typically exists as a white to off-white crystalline powder with a melting point of approximately 85-90 C. The compound has limited water solubility but dissolves in basic aqueous solutions. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong reducing agents, releasing toxic nitrogen oxides and bromine-containing fumes. Proper storage involves keeping it in tightly sealed containers below 25 C, protected from light and moisture. APPLICATIONS: In pharmaceutical research, this compound serves as a lead structure for developing antimicrobial agents. The bromo, chloro, and fluoro substitution provides electron-withdrawing effects that enhance binding to microbial targets, while the nitro group can generate bioactive nitric oxide under physiological conditions (European Journal of Medicinal Chemistry). In materials science, 3-bromo-5-chloro-4-fluoronitrobenzene contributes to the creation of functional organic materials with tailored electronic properties. Its halogenated aromatic core and nitro group influence the electronic characteristics of derived materials, useful in optoelectronic applications such as organic light-emitting diodes (Journal of Materials Chemistry C). The compound can also form coordination complexes with metal ions, expanding applications in supramolecular chemistry and catalysis (Dalton Transactions).
Reviews
Write Your Own Review