3-bromo-5-(trifluoromethoxy)benzonitrile
$250.00
CAS No.: 914635-52-2
Catalog No.: 193985
Purity: 95%
MF: C8H3BrF3NO
MW: 266.016
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C#N)C=C(C1)OC(F)(F)F
Catalog No.: 193985
Purity: 95%
MF: C8H3BrF3NO
MW: 266.016
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C#N)C=C(C1)OC(F)(F)F
3-bromo-5-(trifluoromethoxy)benzonitrile; CAS No.: 914635-52-2;3-bromo-5-(trifluoromethoxy)benzonitrile. PROPERTIES: 3-bromo-5-(trifluoromethoxy)benzonitrile is a brominated and trifluoromethylated aromatic nitrile with molecular formula C8H4BrF3NO. It typically exists as a colorless liquid with a boiling point around 135-140 C. The compound has limited water solubility but dissolves well in organic solvents like dichloromethane or THF. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic bromine vapors. Proper storage involves keeping it in tightly sealed containers below 25 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a versatile intermediate for creating complex aromatic systems. The bromo and trifluoromethoxy substituents provide multiple sites for cross-coupling and nucleophilic substitution reactions, while the nitrile group offers additional functionality for further elaboration (The Journal of Organic Chemistry). In pharmaceutical development, 3-bromo-5-(trifluoromethoxy)benzonitrile contributes to the synthesis of antimicrobial agents where the halogenated aromatic scaffold enhances binding to microbial targets (Antimicrobial Agents and Chemotherapy). The compound also finds application in materials science as a building block for organic electronics, where its electron-deficient aromatic core modulates the electronic properties of derived materials (Advanced Materials).
Reviews
Write Your Own Review